C20H18N2O5S — CID 58652973
(E)-3-(3,4-dihydroxyphenyl)-N-(3-methyl-5-sulfamoylnaphthalen-1-yl)prop-2-enamide (PubChem CID 58652973) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-(3-methyl-5-sulfamoylnaphthalen-1-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-(3-methyl-5-sulfamoylnaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 58652973 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-(3-methyl-5-sulfamoylnaphthalen-1-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(O)c(O)c2)c2cccc(S(N)(=O)=O)c2c1 |
| InChI | InChI=1S/C20H18N2O5S/c1-12-9-15-14(3-2-4-19(15)28(21,26)27)16(10-12)22-20(25)8-6-13-5-7-17(23)18(24)11-13/h2-11,23-24H,1H3,(H,22,25)(H2,21,26,27)/b8-6+ |
| InChIKey | CCBDBGNBHQJQGN-SOFGYWHQSA-N |
| XLogP | 2.86 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|