C24H26N2O7 — CID 175367848
3-(3,4-dihydroxyphenyl)-N-[(1S,3S)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxycyclohexyl]prop-2-enamide (PubChem CID 175367848) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-[(1S,3S)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxycyclohexyl]prop-2-enamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-[(1S,3S)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxycyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 175367848 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-[(1S,3S)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoylamino]-2-hydroxycyclohexyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)N[C@H]1CCC[C@H](NC(=O)C=Cc2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C24H26N2O7/c27-18-8-4-14(12-20(18)29)6-10-22(31)25-16-2-1-3-17(24(16)33)26-23(32)11-7-15-5-9-19(28)21(30)13-15/h4-13,16-17,24,27-30,33H,1-3H2,(H,25,31)(H,26,32)/t16-,17-,24?/m0/s1 |
| InChIKey | QWLLVCAWONDDIT-FEVSBGBPSA-N |
| XLogP | 1.75 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|