C14H12NNaO5S — CID 54719017
sodium 4-[[(Z)-3-hydroxybut-2-enoyl]amino]naphthalene-1-sulfonate (PubChem CID 54719017) has the molecular formula C14H12NNaO5S and a molecular weight of 329.31 g/mol. Its IUPAC name is sodium 4-[[(Z)-3-hydroxybut-2-enoyl]amino]naphthalene-1-sulfonate.
| Compound Name | sodium 4-[[(Z)-3-hydroxybut-2-enoyl]amino]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 54719017 |
| Molecular Formula | C14H12NNaO5S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | sodium 4-[[(Z)-3-hydroxybut-2-enoyl]amino]naphthalene-1-sulfonate |
| SMILES | C/C(O)=C/C(=O)Nc1ccc(S(=O)(=O)[O-])c2ccccc12.[Na+] |
| InChI | InChI=1S/C14H13NO5S.Na/c1-9(16)8-14(17)15-12-6-7-13(21(18,19)20)11-5-3-2-4-10(11)12;/h2-8,16H,1H3,(H,15,17)(H,18,19,20);/q;+1/p-1/b9-8-; |
| InChIKey | YCXJWNHWIKQRLV-UOQXYWCXSA-M |
| XLogP | -0.85 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|