C14H14IN2NaO4S — CID 25059324
sodium 5-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonate (PubChem CID 25059324) has the molecular formula C14H14IN2NaO4S and a molecular weight of 456.24 g/mol. Its IUPAC name is sodium 5-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonate.
| Compound Name | sodium 5-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 25059324 |
| Molecular Formula | C14H14IN2NaO4S |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | sodium 5-[2-[(2-iodoacetyl)amino]ethylamino]naphthalene-1-sulfonate |
| SMILES | O=C(CI)NCCNc1cccc2c(S(=O)(=O)[O-])cccc12.[Na+] |
| InChI | InChI=1S/C14H15IN2O4S.Na/c15-9-14(18)17-8-7-16-12-5-1-4-11-10(12)3-2-6-13(11)22(19,20)21;/h1-6,16H,7-9H2,(H,17,18)(H,19,20,21);/q;+1/p-1 |
| InChIKey | UEADDASJDXPGQU-UHFFFAOYSA-M |
| XLogP | -1.29 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|