C32H31N3O8S — CID 87088608
(2S)-2-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-oxo-5-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]pentanoic acid (PubChem CID 87088608) has the molecular formula C32H31N3O8S and a molecular weight of 617.68 g/mol. Its IUPAC name is (2S)-2-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-oxo-5-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]pentanoic acid.
| Compound Name | (2S)-2-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-oxo-5-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 87088608 |
| Molecular Formula | C32H31N3O8S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | (2S)-2-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-5-oxo-5-[2-[(5-sulfonaphthalen-1-yl)amino]ethylamino]pentanoic acid |
| SMILES | N[C@@](CCC(=O)NCCNc1cccc2c(S(=O)(=O)O)cccc12)(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H31N3O8S/c33-32(30(37)38,31(39)43-19-26-22-9-3-1-7-20(22)21-8-2-4-10-23(21)26)16-15-29(36)35-18-17-34-27-13-5-12-25-24(27)11-6-14-28(25)44(40,41)42/h1-14,26,34H,15-19,33H2,(H,35,36)(H,37,38)(H,40,41,42)/t32-/m0/s1 |
| InChIKey | NHEFXXVJFAFPMX-YTTGMZPUSA-N |
| XLogP | 3.53 |
| TPSA | 185.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|