C10H16N4O3S — CID 83117083
2-(2-amino-3-methylsulfonylanilino)ethylurea (PubChem CID 83117083) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-(2-amino-3-methylsulfonylanilino)ethylurea.
| Compound Name | 2-(2-amino-3-methylsulfonylanilino)ethylurea |
|---|---|
| PubChem CID | 83117083 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(2-amino-3-methylsulfonylanilino)ethylurea |
| SMILES | CS(=O)(=O)c1cccc(NCCNC(N)=O)c1N |
| InChI | InChI=1S/C10H16N4O3S/c1-18(16,17)8-4-2-3-7(9(8)11)13-5-6-14-10(12)15/h2-4,13H,5-6,11H2,1H3,(H3,12,14,15) |
| InChIKey | HNMDOCAIKYHGRO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|