C10H13F3N2O2S2 — CID 106426460
3-methylsulfonyl-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine (PubChem CID 106426460) has the molecular formula C10H13F3N2O2S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-methylsulfonyl-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine.
| Compound Name | 3-methylsulfonyl-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106426460 |
| Molecular Formula | C10H13F3N2O2S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-methylsulfonyl-1-N-[2-(trifluoromethylsulfanyl)ethyl]benzene-1,2-diamine |
| SMILES | CS(=O)(=O)c1cccc(NCCSC(F)(F)F)c1N |
| InChI | InChI=1S/C10H13F3N2O2S2/c1-19(16,17)8-4-2-3-7(9(8)14)15-5-6-18-10(11,12)13/h2-4,15H,5-6,14H2,1H3 |
| InChIKey | BSSSLBGZMKMDTF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|