C15H26N2O2S — CID 82002582
3-methylsulfonyl-1-N-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diamine (PubChem CID 82002582) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-methylsulfonyl-1-N-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diamine.
| Compound Name | 3-methylsulfonyl-1-N-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 82002582 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-methylsulfonyl-1-N-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diamine |
| SMILES | CC(C)(C)CC(C)(C)Nc1cccc(S(C)(=O)=O)c1N |
| InChI | InChI=1S/C15H26N2O2S/c1-14(2,3)10-15(4,5)17-11-8-7-9-12(13(11)16)20(6,18)19/h7-9,17H,10,16H2,1-6H3 |
| InChIKey | FLVLZCTUXPVGFP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|