C12H12NNaO8S3 — CID 23692291
sodium 5-(methanesulfonamido)-1-methylsulfonyloxynaphthalene-2-sulfonate (PubChem CID 23692291) has the molecular formula C12H12NNaO8S3 and a molecular weight of 417.42 g/mol. Its IUPAC name is sodium 5-(methanesulfonamido)-1-methylsulfonyloxynaphthalene-2-sulfonate.
| Compound Name | sodium 5-(methanesulfonamido)-1-methylsulfonyloxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 23692291 |
| Molecular Formula | C12H12NNaO8S3 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | sodium 5-(methanesulfonamido)-1-methylsulfonyloxynaphthalene-2-sulfonate |
| SMILES | CS(=O)(=O)Nc1cccc2c(OS(C)(=O)=O)c(S(=O)(=O)[O-])ccc12.[Na+] |
| InChI | InChI=1S/C12H13NO8S3.Na/c1-22(14,15)13-10-5-3-4-9-8(10)6-7-11(24(18,19)20)12(9)21-23(2,16)17;/h3-7,13H,1-2H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | DLZRAKGXWVKRGU-UHFFFAOYSA-M |
| XLogP | -2.54 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|