C18H24O18S6 — CID 159669792
[2,3-bis(methylsulfonyloxy)phenyl] methanesulfonate (PubChem CID 159669792) has the molecular formula C18H24O18S6 and a molecular weight of 720.77 g/mol. Its IUPAC name is [2,3-bis(methylsulfonyloxy)phenyl] methanesulfonate.
| Compound Name | [2,3-bis(methylsulfonyloxy)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 159669792 |
| Molecular Formula | C18H24O18S6 |
| Molecular Weight | 720.77 g/mol |
| Exact Mass | 719.93 |
| IUPAC Name | [2,3-bis(methylsulfonyloxy)phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(OS(C)(=O)=O)c1OS(C)(=O)=O.CS(=O)(=O)Oc1cccc(OS(C)(=O)=O)c1OS(C)(=O)=O |
| InChI | InChI=1S/2C9H12O9S3/c2*1-19(10,11)16-7-5-4-6-8(17-20(2,12)13)9(7)18-21(3,14)15/h2*4-6H,1-3H3 |
| InChIKey | MTVWOORKTWQIIW-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 260.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.77 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|