C12H12O9S3 — CID 10092133
4,8-bis(methylsulfonyloxy)naphthalene-2-sulfonic acid (PubChem CID 10092133) has the molecular formula C12H12O9S3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 4,8-bis(methylsulfonyloxy)naphthalene-2-sulfonic acid.
| Compound Name | 4,8-bis(methylsulfonyloxy)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 10092133 |
| Molecular Formula | C12H12O9S3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 4,8-bis(methylsulfonyloxy)naphthalene-2-sulfonic acid |
| SMILES | CS(=O)(=O)Oc1cc(S(=O)(=O)O)cc2c(OS(C)(=O)=O)cccc12 |
| InChI | InChI=1S/C12H12O9S3/c1-22(13,14)20-11-5-3-4-9-10(11)6-8(24(17,18)19)7-12(9)21-23(2,15)16/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | DJGHMSAJLMPQLL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|