C19H23NO6S2 — CID 91179025
4-(benzenesulfonyloxy)naphthalene-2-sulfonic acid;ethane;methanamine (PubChem CID 91179025) has the molecular formula C19H23NO6S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-(benzenesulfonyloxy)naphthalene-2-sulfonic acid;ethane;methanamine.
| Compound Name | 4-(benzenesulfonyloxy)naphthalene-2-sulfonic acid;ethane;methanamine |
|---|---|
| PubChem CID | 91179025 |
| Molecular Formula | C19H23NO6S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 4-(benzenesulfonyloxy)naphthalene-2-sulfonic acid;ethane;methanamine |
| SMILES | CC.CN.O=S(=O)(O)c1cc(OS(=O)(=O)c2ccccc2)c2ccccc2c1 |
| InChI | InChI=1S/C16H12O6S2.C2H6.CH5N/c17-23(18,19)14-10-12-6-4-5-9-15(12)16(11-14)22-24(20,21)13-7-2-1-3-8-13;2*1-2/h1-11H,(H,17,18,19);1-2H3;2H2,1H3 |
| InChIKey | NYJPEQAKLAQMFS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|