C30H20O16S5 — CID 88760637
4-[5-(5-hydroxynaphthalen-1-yl)sulfonyloxy-7-sulfonaphthalen-2-yl]sulfonyloxynaphthalene-2,6-disulfonic acid (PubChem CID 88760637) has the molecular formula C30H20O16S5 and a molecular weight of 796.81 g/mol. Its IUPAC name is 4-[5-(5-hydroxynaphthalen-1-yl)sulfonyloxy-7-sulfonaphthalen-2-yl]sulfonyloxynaphthalene-2,6-disulfonic acid.
| Compound Name | 4-[5-(5-hydroxynaphthalen-1-yl)sulfonyloxy-7-sulfonaphthalen-2-yl]sulfonyloxynaphthalene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 88760637 |
| Molecular Formula | C30H20O16S5 |
| Molecular Weight | 796.81 g/mol |
| Exact Mass | 795.94 |
| IUPAC Name | 4-[5-(5-hydroxynaphthalen-1-yl)sulfonyloxy-7-sulfonaphthalen-2-yl]sulfonyloxynaphthalene-2,6-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(OS(=O)(=O)c2ccc3c(OS(=O)(=O)c4cccc5c(O)cccc45)cc(S(=O)(=O)O)cc3c2)c2cc(S(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C30H20O16S5/c31-27-5-1-4-25-24(27)3-2-6-30(25)51(43,44)46-28-15-22(49(38,39)40)13-18-12-20(9-10-23(18)28)50(41,42)45-29-16-21(48(35,36)37)11-17-7-8-19(14-26(17)29)47(32,33)34/h1-16,31H,(H,32,33,34)(H,35,36,37)(H,38,39,40) |
| InChIKey | CAPOZRTZSVKDHA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 270.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|