C20H14O12S3 — CID 91605554
4,5-dihydroxy-7-(3-hydroxy-7-sulfonaphthalen-2-yl)oxysulfonylnaphthalene-2-sulfonic acid (PubChem CID 91605554) has the molecular formula C20H14O12S3 and a molecular weight of 542.52 g/mol. Its IUPAC name is 4,5-dihydroxy-7-(3-hydroxy-7-sulfonaphthalen-2-yl)oxysulfonylnaphthalene-2-sulfonic acid.
| Compound Name | 4,5-dihydroxy-7-(3-hydroxy-7-sulfonaphthalen-2-yl)oxysulfonylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 91605554 |
| Molecular Formula | C20H14O12S3 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 541.96 |
| IUPAC Name | 4,5-dihydroxy-7-(3-hydroxy-7-sulfonaphthalen-2-yl)oxysulfonylnaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2cc(O)c(OS(=O)(=O)c3cc(O)c4c(O)cc(S(=O)(=O)O)cc4c3)cc2c1 |
| InChI | InChI=1S/C20H14O12S3/c21-16-6-10-1-2-13(33(24,25)26)3-11(10)7-19(16)32-35(30,31)15-5-12-4-14(34(27,28)29)8-17(22)20(12)18(23)9-15/h1-9,21-23H,(H,24,25,26)(H,27,28,29) |
| InChIKey | AEKKNUWDFOUVKG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 212.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|