C17H14O6S2 — CID 22352898
4-(4-methylphenyl)sulfonyloxynaphthalene-1-sulfonic acid (PubChem CID 22352898) has the molecular formula C17H14O6S2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyloxynaphthalene-1-sulfonic acid.
| Compound Name | 4-(4-methylphenyl)sulfonyloxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 22352898 |
| Molecular Formula | C17H14O6S2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyloxynaphthalene-1-sulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(S(=O)(=O)O)c3ccccc23)cc1 |
| InChI | InChI=1S/C17H14O6S2/c1-12-6-8-13(9-7-12)25(21,22)23-16-10-11-17(24(18,19)20)15-5-3-2-4-14(15)16/h2-11H,1H3,(H,18,19,20) |
| InChIKey | XLSBGYGFLIAKKI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|