C24H22O17S6 — CID 10327867
[5,8-bis(methylsulfonyloxy)naphthalen-2-yl]sulfonyl 5,8-bis(methylsulfonyloxy)naphthalene-1-sulfonate (PubChem CID 10327867) has the molecular formula C24H22O17S6 and a molecular weight of 774.83 g/mol. Its IUPAC name is [5,8-bis(methylsulfonyloxy)naphthalen-2-yl]sulfonyl 5,8-bis(methylsulfonyloxy)naphthalene-1-sulfonate.
| Compound Name | [5,8-bis(methylsulfonyloxy)naphthalen-2-yl]sulfonyl 5,8-bis(methylsulfonyloxy)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 10327867 |
| Molecular Formula | C24H22O17S6 |
| Molecular Weight | 774.83 g/mol |
| Exact Mass | 773.92 |
| IUPAC Name | [5,8-bis(methylsulfonyloxy)naphthalen-2-yl]sulfonyl 5,8-bis(methylsulfonyloxy)naphthalene-1-sulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(OS(C)(=O)=O)c2cc(S(=O)(=O)OS(=O)(=O)c3cccc4c(OS(C)(=O)=O)ccc(OS(C)(=O)=O)c34)ccc12 |
| InChI | InChI=1S/C24H22O17S6/c1-42(25,26)37-19-10-11-21(39-44(3,29)30)18-14-15(8-9-16(18)19)46(33,34)41-47(35,36)23-7-5-6-17-20(38-43(2,27)28)12-13-22(24(17)23)40-45(4,31)32/h5-14H,1-4H3 |
| InChIKey | RPBZOAYLVWLAGW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 250.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|