C35H28O12S3 — CID 22903235
[5,10-bis[(3-hydroxy-4-methylphenyl)sulfonyloxy]anthracen-1-yl] 3-hydroxy-4-methylbenzenesulfonate (PubChem CID 22903235) has the molecular formula C35H28O12S3 and a molecular weight of 736.80 g/mol. Its IUPAC name is [5,10-bis[(3-hydroxy-4-methylphenyl)sulfonyloxy]anthracen-1-yl] 3-hydroxy-4-methylbenzenesulfonate.
| Compound Name | [5,10-bis[(3-hydroxy-4-methylphenyl)sulfonyloxy]anthracen-1-yl] 3-hydroxy-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22903235 |
| Molecular Formula | C35H28O12S3 |
| Molecular Weight | 736.80 g/mol |
| Exact Mass | 736.07 |
| IUPAC Name | [5,10-bis[(3-hydroxy-4-methylphenyl)sulfonyloxy]anthracen-1-yl] 3-hydroxy-4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc3c(OS(=O)(=O)c4ccc(C)c(O)c4)c4c(OS(=O)(=O)c5ccc(C)c(O)c5)cccc4cc23)cc1O |
| InChI | InChI=1S/C35H28O12S3/c1-20-10-13-24(17-29(20)36)48(39,40)45-32-8-5-7-27-28(32)16-23-6-4-9-33(46-49(41,42)25-14-11-21(2)30(37)18-25)34(23)35(27)47-50(43,44)26-15-12-22(3)31(38)19-26/h4-19,36-38H,1-3H3 |
| InChIKey | MJYSOFGEQMZTQK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|