C13H13NO5S2 — CID 26526951
(2-methylphenyl) 4-sulfamoylbenzenesulfonate (PubChem CID 26526951) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2-methylphenyl) 4-sulfamoylbenzenesulfonate.
| Compound Name | (2-methylphenyl) 4-sulfamoylbenzenesulfonate |
|---|---|
| PubChem CID | 26526951 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (2-methylphenyl) 4-sulfamoylbenzenesulfonate |
| SMILES | Cc1ccccc1OS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H13NO5S2/c1-10-4-2-3-5-13(10)19-21(17,18)12-8-6-11(7-9-12)20(14,15)16/h2-9H,1H3,(H2,14,15,16) |
| InChIKey | OKRWTTBQUSDFPG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|