C20H28N2O9S2 — CID 157075089
molecular hydrogen;5-[2-[[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylacetyl]amino]ethylamino]naphthalene-1-sulfonic acid (PubChem CID 157075089) has the molecular formula C20H28N2O9S2 and a molecular weight of 504.58 g/mol. Its IUPAC name is molecular hydrogen;5-[2-[[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylacetyl]amino]ethylamino]naphthalene-1-sulfonic acid.
| Compound Name | molecular hydrogen;5-[2-[[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylacetyl]amino]ethylamino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 157075089 |
| Molecular Formula | C20H28N2O9S2 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | molecular hydrogen;5-[2-[[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylacetyl]amino]ethylamino]naphthalene-1-sulfonic acid |
| SMILES | O=C(CSC1OC(CO)C(O)C(O)C1O)NCCNc1cccc2c(S(=O)(=O)O)cccc12.[H][H] |
| InChI | InChI=1S/C20H26N2O9S2.H2/c23-9-14-17(25)18(26)19(27)20(31-14)32-10-16(24)22-8-7-21-13-5-1-4-12-11(13)3-2-6-15(12)33(28,29)30;/h1-6,14,17-21,23,25-27H,7-10H2,(H,22,24)(H,28,29,30);1H |
| InChIKey | ACWMTSFPKGASIY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 185.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|