C23H40N2O14S2 — CID 57035602
(2S)-2,5-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]pentanoic acid (PubChem CID 57035602) has the molecular formula C23H40N2O14S2 and a molecular weight of 632.71 g/mol. Its IUPAC name is (2S)-2,5-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]pentanoic acid.
| Compound Name | (2S)-2,5-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 57035602 |
| Molecular Formula | C23H40N2O14S2 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | (2S)-2,5-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]pentanoic acid |
| SMILES | O=C(CCS[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)NCCC[C@H](NC(=O)CCS[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C23H40N2O14S2/c26-8-11-15(30)17(32)19(34)22(38-11)40-6-3-13(28)24-5-1-2-10(21(36)37)25-14(29)4-7-41-23-20(35)18(33)16(31)12(9-27)39-23/h10-12,15-20,22-23,26-27,30-35H,1-9H2,(H,24,28)(H,25,29)(H,36,37)/t10-,11+,12+,15+,16+,17-,18-,19-,20-,22+,23+/m0/s1 |
| InChIKey | WTMXTWTZEWOYLV-UABCEKQSSA-N |
| XLogP | -4.70 |
| TPSA | 275.80 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|