C24H42N2O14S2 — CID 70464797
(2R)-2,6-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]hexanoic acid (PubChem CID 70464797) has the molecular formula C24H42N2O14S2 and a molecular weight of 646.73 g/mol. Its IUPAC name is (2R)-2,6-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]hexanoic acid.
| Compound Name | (2R)-2,6-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 70464797 |
| Molecular Formula | C24H42N2O14S2 |
| Molecular Weight | 646.73 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | (2R)-2,6-bis[3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoylamino]hexanoic acid |
| SMILES | O=C(CCS[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)NCCCC[C@@H](NC(=O)CCS[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C24H42N2O14S2/c27-9-12-16(31)18(33)20(35)23(39-12)41-7-4-14(29)25-6-2-1-3-11(22(37)38)26-15(30)5-8-42-24-21(36)19(34)17(32)13(10-28)40-24/h11-13,16-21,23-24,27-28,31-36H,1-10H2,(H,25,29)(H,26,30)(H,37,38)/t11-,12-,13-,16-,17-,18+,19+,20+,21+,23-,24-/m1/s1 |
| InChIKey | YDLVBYLSUOZKSI-SUGGQOCPSA-N |
| XLogP | -4.31 |
| TPSA | 275.80 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.73 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|