C28H50N2O16 — CID 122496115
N-[(3S)-2-oxo-7-[[2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]acetyl]amino]heptan-3-yl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide (PubChem CID 122496115) has the molecular formula C28H50N2O16 and a molecular weight of 670.71 g/mol. Its IUPAC name is N-[(3S)-2-oxo-7-[[2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]acetyl]amino]heptan-3-yl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide.
| Compound Name | N-[(3S)-2-oxo-7-[[2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]acetyl]amino]heptan-3-yl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
|---|---|
| PubChem CID | 122496115 |
| Molecular Formula | C28H50N2O16 |
| Molecular Weight | 670.71 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | N-[(3S)-2-oxo-7-[[2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]acetyl]amino]heptan-3-yl]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
| SMILES | CC(=O)[C@H](CCCCNC(=O)COCCOC1OC(CO)C(O)C(O)C1O)NC(=O)CCCCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C28H50N2O16/c1-15(33)16(30-19(34)7-3-5-9-43-27-25(40)23(38)21(36)17(12-31)45-27)6-2-4-8-29-20(35)14-42-10-11-44-28-26(41)24(39)22(37)18(13-32)46-28/h16-18,21-28,31-32,36-41H,2-14H2,1H3,(H,29,35)(H,30,34)/t16-,17?,18?,21?,22?,23?,24?,25?,26?,27?,28?/m0/s1 |
| InChIKey | SFYOVKMSZOUGBF-IAFNTXESSA-N |
| XLogP | -4.83 |
| TPSA | 283.26 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.71 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|