C30H52N2O15 — CID 146323009
N-[(5S)-6-oxo-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]heptyl]-5-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]pentanamide (PubChem CID 146323009) has the molecular formula C30H52N2O15 and a molecular weight of 680.74 g/mol. Its IUPAC name is N-[(5S)-6-oxo-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]heptyl]-5-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]pentanamide.
| Compound Name | N-[(5S)-6-oxo-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]heptyl]-5-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]pentanamide |
|---|---|
| PubChem CID | 146323009 |
| Molecular Formula | C30H52N2O15 |
| Molecular Weight | 680.74 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | N-[(5S)-6-oxo-5-[5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanoylamino]heptyl]-5-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]oxy]pentanamide |
| SMILES | CC(=O)[C@H](CCCCNC(=O)CCCCOC1OC2(O)C(CO)C(O)C(O)C12)NC(=O)CCCCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C30H52N2O15/c1-16(35)18(32-21(37)10-4-7-13-45-29-27(42)26(41)24(39)19(15-34)46-29)8-2-5-11-31-20(36)9-3-6-12-44-28-22-25(40)23(38)17(14-33)30(22,43)47-28/h17-19,22-29,33-34,38-43H,2-15H2,1H3,(H,31,36)(H,32,37)/t17?,18-,19?,22?,23?,24?,25?,26?,27?,28?,29?,30?/m0/s1 |
| InChIKey | MBZRIAXPJKQQJB-UTJNMCBTSA-N |
| XLogP | -3.47 |
| TPSA | 274.03 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.74 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|