C20H37NO7 — CID 146232107
5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-[(3R)-2-oxooctan-3-yl]pentanamide (PubChem CID 146232107) has the molecular formula C20H37NO7 and a molecular weight of 403.52 g/mol. Its IUPAC name is 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-[(3R)-2-oxooctan-3-yl]pentanamide.
| Compound Name | 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-[(3R)-2-oxooctan-3-yl]pentanamide |
|---|---|
| PubChem CID | 146232107 |
| Molecular Formula | C20H37NO7 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 5-[4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-N-[(3R)-2-oxooctan-3-yl]pentanamide |
| SMILES | CCCCC[C@@H](NC(=O)CCCCOC1OC(CO)C(O)C(O)C1C)C(C)=O |
| InChI | InChI=1S/C20H37NO7/c1-4-5-6-9-15(14(3)23)21-17(24)10-7-8-11-27-20-13(2)18(25)19(26)16(12-22)28-20/h13,15-16,18-20,22,25-26H,4-12H2,1-3H3,(H,21,24)/t13?,15-,16?,18?,19?,20?/m1/s1 |
| InChIKey | YSXMWVQMPLNDQD-DHBZTJSTSA-N |
| XLogP | 0.90 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|