C12H16N2O — CID 130012074
N-(3-amino-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 130012074) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-(3-amino-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | N-(3-amino-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 130012074 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-(3-amino-5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CC(=O)Nc1cc(N)cc2c1CCCC2 |
| InChI | InChI=1S/C12H16N2O/c1-8(15)14-12-7-10(13)6-9-4-2-3-5-11(9)12/h6-7H,2-5,13H2,1H3,(H,14,15) |
| InChIKey | ZOPHVGOHRMDAQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|