C24H28FNO4 — CID 160683449
methyl 3-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate;methyl 3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate (PubChem CID 160683449) has the molecular formula C24H28FNO4 and a molecular weight of 413.49 g/mol. Its IUPAC name is methyl 3-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate;methyl 3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate.
| Compound Name | methyl 3-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate;methyl 3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 160683449 |
| Molecular Formula | C24H28FNO4 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 3-amino-5,6,7,8-tetrahydronaphthalene-1-carboxylate;methyl 3-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)c1cc(F)cc2c1CCCC2.COC(=O)c1cc(N)cc2c1CCCC2 |
| InChI | InChI=1S/C12H13FO2.C12H15NO2/c2*1-15-12(14)11-7-9(13)6-8-4-2-3-5-10(8)11/h6-7H,2-5H2,1H3;6-7H,2-5,13H2,1H3 |
| InChIKey | ROLKEVIPQAHFKQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|