About N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide
N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide (PubChem CID 84777244) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide |
| PubChem CID | 84777244 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc(C=O)c2c(c1)CCC2 |
| InChI | InChI=1S/C12H13NO2/c1-8(15)13-11-5-9-3-2-4-12(9)10(6-11)7-14/h5-7H,2-4H2,1H3,(H,13,15) |
| InChIKey | XCFZORPCIZIVGV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide?
The IUPAC name of N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide (CID 84777244) is N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide.
What is the SMILES notation for N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide?
The canonical SMILES for N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide is CC(=O)Nc1cc(C=O)c2c(c1)CCC2.
What is the InChIKey of N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide?
The InChIKey is XCFZORPCIZIVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-8(15)13-11-5-9-3-2-4-12(9)10(6-11)7-14/h5-7H,2-4H2,1H3,(H,13,15).
What are the key properties of N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide?
N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide has a molecular weight of 203.24 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-formyl-2,3-dihydro-1H-inden-5-yl)acetamide is sourced from PubChem (CID 84777244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).