C11H11BrN2O3 — CID 146380434
N-(6-bromo-4-nitro-2,3-dihydro-1H-inden-5-yl)acetamide (PubChem CID 146380434) has the molecular formula C11H11BrN2O3 and a molecular weight of 299.12 g/mol. Its IUPAC name is N-(6-bromo-4-nitro-2,3-dihydro-1H-inden-5-yl)acetamide.
| Compound Name | N-(6-bromo-4-nitro-2,3-dihydro-1H-inden-5-yl)acetamide |
|---|---|
| PubChem CID | 146380434 |
| Molecular Formula | C11H11BrN2O3 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-(6-bromo-4-nitro-2,3-dihydro-1H-inden-5-yl)acetamide |
| SMILES | CC(=O)Nc1c(Br)cc2c(c1[N+](=O)[O-])CCC2 |
| InChI | InChI=1S/C11H11BrN2O3/c1-6(15)13-10-9(12)5-7-3-2-4-8(7)11(10)14(16)17/h5H,2-4H2,1H3,(H,13,15) |
| InChIKey | OYCFKTFYNHGFOX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|