C10H8FN5O8 — CID 12577939
N-(3-acetamido-5-fluoro-2,4,6-trinitrophenyl)acetamide (PubChem CID 12577939) has the molecular formula C10H8FN5O8 and a molecular weight of 345.20 g/mol. Its IUPAC name is N-(3-acetamido-5-fluoro-2,4,6-trinitrophenyl)acetamide.
| Compound Name | N-(3-acetamido-5-fluoro-2,4,6-trinitrophenyl)acetamide |
|---|---|
| PubChem CID | 12577939 |
| Molecular Formula | C10H8FN5O8 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(3-acetamido-5-fluoro-2,4,6-trinitrophenyl)acetamide |
| SMILES | CC(=O)Nc1c([N+](=O)[O-])c(F)c([N+](=O)[O-])c(NC(C)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8FN5O8/c1-3(17)12-6-8(14(19)20)5(11)9(15(21)22)7(13-4(2)18)10(6)16(23)24/h1-2H3,(H,12,17)(H,13,18) |
| InChIKey | QKBRCJDLTIVFEQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 187.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|