C11H12N4O6 — CID 102249243
N-(3-acetamido-6-methyl-2,4-dinitrophenyl)acetamide (PubChem CID 102249243) has the molecular formula C11H12N4O6 and a molecular weight of 296.24 g/mol. Its IUPAC name is N-(3-acetamido-6-methyl-2,4-dinitrophenyl)acetamide.
| Compound Name | N-(3-acetamido-6-methyl-2,4-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 102249243 |
| Molecular Formula | C11H12N4O6 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(3-acetamido-6-methyl-2,4-dinitrophenyl)acetamide |
| SMILES | CC(=O)Nc1c(C)cc([N+](=O)[O-])c(NC(C)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N4O6/c1-5-4-8(14(18)19)10(13-7(3)17)11(15(20)21)9(5)12-6(2)16/h4H,1-3H3,(H,12,16)(H,13,17) |
| InChIKey | RJGRSIKKFRBXMD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|