C8H5BrCl2N2O3 — CID 12622271
N-(4-bromo-2,6-dichloro-3-nitrophenyl)acetamide (PubChem CID 12622271) has the molecular formula C8H5BrCl2N2O3 and a molecular weight of 327.95 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichloro-3-nitrophenyl)acetamide.
| Compound Name | N-(4-bromo-2,6-dichloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 12622271 |
| Molecular Formula | C8H5BrCl2N2O3 |
| Molecular Weight | 327.95 g/mol |
| Exact Mass | 325.89 |
| IUPAC Name | N-(4-bromo-2,6-dichloro-3-nitrophenyl)acetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(Br)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C8H5BrCl2N2O3/c1-3(14)12-7-5(10)2-4(9)8(6(7)11)13(15)16/h2H,1H3,(H,12,14) |
| InChIKey | TVYUBXILPGLIDA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|