C11H13N3O6 — CID 23335980
ethyl N-(3,4-dimethyl-2,6-dinitrophenyl)carbamate (PubChem CID 23335980) has the molecular formula C11H13N3O6 and a molecular weight of 283.24 g/mol. Its IUPAC name is ethyl N-(3,4-dimethyl-2,6-dinitrophenyl)carbamate.
| Compound Name | ethyl N-(3,4-dimethyl-2,6-dinitrophenyl)carbamate |
|---|---|
| PubChem CID | 23335980 |
| Molecular Formula | C11H13N3O6 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | ethyl N-(3,4-dimethyl-2,6-dinitrophenyl)carbamate |
| SMILES | CCOC(=O)Nc1c([N+](=O)[O-])cc(C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O6/c1-4-20-11(15)12-9-8(13(16)17)5-6(2)7(3)10(9)14(18)19/h5H,4H2,1-3H3,(H,12,15) |
| InChIKey | XRKKKYJICJMMEM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|