C9H7ClF2N2O4 — CID 18315089
ethyl N-(4-chloro-2,6-difluoro-3-nitrophenyl)carbamate (PubChem CID 18315089) has the molecular formula C9H7ClF2N2O4 and a molecular weight of 280.61 g/mol. Its IUPAC name is ethyl N-(4-chloro-2,6-difluoro-3-nitrophenyl)carbamate.
| Compound Name | ethyl N-(4-chloro-2,6-difluoro-3-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 18315089 |
| Molecular Formula | C9H7ClF2N2O4 |
| Molecular Weight | 280.61 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | ethyl N-(4-chloro-2,6-difluoro-3-nitrophenyl)carbamate |
| SMILES | CCOC(=O)Nc1c(F)cc(Cl)c([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H7ClF2N2O4/c1-2-18-9(15)13-7-5(11)3-4(10)8(6(7)12)14(16)17/h3H,2H2,1H3,(H,13,15) |
| InChIKey | AJPYNYPLXWKYDK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|