C9H9ClFNO2S — CID 139638488
ethyl N-(4-chloro-2-fluoro-5-sulfanylphenyl)carbamate (PubChem CID 139638488) has the molecular formula C9H9ClFNO2S and a molecular weight of 249.69 g/mol. Its IUPAC name is ethyl N-(4-chloro-2-fluoro-5-sulfanylphenyl)carbamate.
| Compound Name | ethyl N-(4-chloro-2-fluoro-5-sulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 139638488 |
| Molecular Formula | C9H9ClFNO2S |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | ethyl N-(4-chloro-2-fluoro-5-sulfanylphenyl)carbamate |
| SMILES | CCOC(=O)Nc1cc(S)c(Cl)cc1F |
| InChI | InChI=1S/C9H9ClFNO2S/c1-2-14-9(13)12-7-4-8(15)5(10)3-6(7)11/h3-4,15H,2H2,1H3,(H,12,13) |
| InChIKey | HZJKXGVERUOKDT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|