C11H14BrFN2O4S — CID 11245619
ethyl N-[4-bromo-5-(ethylsulfonylamino)-2-fluorophenyl]carbamate (PubChem CID 11245619) has the molecular formula C11H14BrFN2O4S and a molecular weight of 369.21 g/mol. Its IUPAC name is ethyl N-[4-bromo-5-(ethylsulfonylamino)-2-fluorophenyl]carbamate.
| Compound Name | ethyl N-[4-bromo-5-(ethylsulfonylamino)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 11245619 |
| Molecular Formula | C11H14BrFN2O4S |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | ethyl N-[4-bromo-5-(ethylsulfonylamino)-2-fluorophenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(NS(=O)(=O)CC)c(Br)cc1F |
| InChI | InChI=1S/C11H14BrFN2O4S/c1-3-19-11(16)14-10-6-9(7(12)5-8(10)13)15-20(17,18)4-2/h5-6,15H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | ZLELBFJXECHPLL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |