C12H13BrFNO2S — CID 139689956
O-ethyl 2-(5-acetamido-2-bromo-4-fluorophenyl)ethanethioate (PubChem CID 139689956) has the molecular formula C12H13BrFNO2S and a molecular weight of 334.21 g/mol. Its IUPAC name is O-ethyl 2-(5-acetamido-2-bromo-4-fluorophenyl)ethanethioate.
| Compound Name | O-ethyl 2-(5-acetamido-2-bromo-4-fluorophenyl)ethanethioate |
|---|---|
| PubChem CID | 139689956 |
| Molecular Formula | C12H13BrFNO2S |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | O-ethyl 2-(5-acetamido-2-bromo-4-fluorophenyl)ethanethioate |
| SMILES | CCOC(=S)Cc1cc(NC(C)=O)c(F)cc1Br |
| InChI | InChI=1S/C12H13BrFNO2S/c1-3-17-12(18)5-8-4-11(15-7(2)16)10(14)6-9(8)13/h4,6H,3,5H2,1-2H3,(H,15,16) |
| InChIKey | ABRTVDUEINDIMP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|