C15H19BrFNO2S — CID 139689897
O-propyl 2-[2-bromo-5-(butanoylamino)-4-fluorophenyl]ethanethioate (PubChem CID 139689897) has the molecular formula C15H19BrFNO2S and a molecular weight of 376.29 g/mol. Its IUPAC name is O-propyl 2-[2-bromo-5-(butanoylamino)-4-fluorophenyl]ethanethioate.
| Compound Name | O-propyl 2-[2-bromo-5-(butanoylamino)-4-fluorophenyl]ethanethioate |
|---|---|
| PubChem CID | 139689897 |
| Molecular Formula | C15H19BrFNO2S |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | O-propyl 2-[2-bromo-5-(butanoylamino)-4-fluorophenyl]ethanethioate |
| SMILES | CCCOC(=S)Cc1cc(NC(=O)CCC)c(F)cc1Br |
| InChI | InChI=1S/C15H19BrFNO2S/c1-3-5-14(19)18-13-7-10(11(16)9-12(13)17)8-15(21)20-6-4-2/h7,9H,3-6,8H2,1-2H3,(H,18,19) |
| InChIKey | FDAFFHVGMWKFBJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|