C13H15ClFNO2S — CID 139690212
O-methyl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]ethanethioate (PubChem CID 139690212) has the molecular formula C13H15ClFNO2S and a molecular weight of 303.79 g/mol. Its IUPAC name is O-methyl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]ethanethioate.
| Compound Name | O-methyl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]ethanethioate |
|---|---|
| PubChem CID | 139690212 |
| Molecular Formula | C13H15ClFNO2S |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | O-methyl 2-[5-(butanoylamino)-2-chloro-4-fluorophenyl]ethanethioate |
| SMILES | CCCC(=O)Nc1cc(CC(=S)OC)c(Cl)cc1F |
| InChI | InChI=1S/C13H15ClFNO2S/c1-3-4-12(17)16-11-5-8(6-13(19)18-2)9(14)7-10(11)15/h5,7H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | SDTISBSFKBKPAF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|