C15H19ClFNO3S — CID 139701599
methyl 2-[2-chloro-4-fluoro-5-(pentanoylamino)phenyl]sulfanylpropanoate (PubChem CID 139701599) has the molecular formula C15H19ClFNO3S and a molecular weight of 347.84 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-fluoro-5-(pentanoylamino)phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-chloro-4-fluoro-5-(pentanoylamino)phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 139701599 |
| Molecular Formula | C15H19ClFNO3S |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | methyl 2-[2-chloro-4-fluoro-5-(pentanoylamino)phenyl]sulfanylpropanoate |
| SMILES | CCCCC(=O)Nc1cc(SC(C)C(=O)OC)c(Cl)cc1F |
| InChI | InChI=1S/C15H19ClFNO3S/c1-4-5-6-14(19)18-12-8-13(10(16)7-11(12)17)22-9(2)15(20)21-3/h7-9H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | OGXGCEDSSHKOGU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |