C20H29ClFNO3S — CID 139701642
2-methylpropyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]sulfanylbutanoate (PubChem CID 139701642) has the molecular formula C20H29ClFNO3S and a molecular weight of 417.97 g/mol. Its IUPAC name is 2-methylpropyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]sulfanylbutanoate.
| Compound Name | 2-methylpropyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 139701642 |
| Molecular Formula | C20H29ClFNO3S |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-methylpropyl 2-[2-chloro-4-fluoro-5-(4-methylpentanoylamino)phenyl]sulfanylbutanoate |
| SMILES | CCC(Sc1cc(NC(=O)CCC(C)C)c(F)cc1Cl)C(=O)OCC(C)C |
| InChI | InChI=1S/C20H29ClFNO3S/c1-6-17(20(25)26-11-13(4)5)27-18-10-16(15(22)9-14(18)21)23-19(24)8-7-12(2)3/h9-10,12-13,17H,6-8,11H2,1-5H3,(H,23,24) |
| InChIKey | XCRSNPSIQDYYGJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |