C19H27ClFNO3S — CID 139701699
propan-2-yl 2-[2-chloro-4-fluoro-5-(3-methylpentanoylamino)phenyl]sulfanylbutanoate (PubChem CID 139701699) has the molecular formula C19H27ClFNO3S and a molecular weight of 403.95 g/mol. Its IUPAC name is propan-2-yl 2-[2-chloro-4-fluoro-5-(3-methylpentanoylamino)phenyl]sulfanylbutanoate.
| Compound Name | propan-2-yl 2-[2-chloro-4-fluoro-5-(3-methylpentanoylamino)phenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 139701699 |
| Molecular Formula | C19H27ClFNO3S |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | propan-2-yl 2-[2-chloro-4-fluoro-5-(3-methylpentanoylamino)phenyl]sulfanylbutanoate |
| SMILES | CCC(C)CC(=O)Nc1cc(SC(CC)C(=O)OC(C)C)c(Cl)cc1F |
| InChI | InChI=1S/C19H27ClFNO3S/c1-6-12(5)8-18(23)22-15-10-17(13(20)9-14(15)21)26-16(7-2)19(24)25-11(3)4/h9-12,16H,6-8H2,1-5H3,(H,22,23) |
| InChIKey | AAHVYWPJFFPHIX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |