C21H23ClFNO3S — CID 139689716
propan-2-yl 2-(5-benzamido-2-chloro-4-fluorophenyl)sulfanylpentanoate (PubChem CID 139689716) has the molecular formula C21H23ClFNO3S and a molecular weight of 423.94 g/mol. Its IUPAC name is propan-2-yl 2-(5-benzamido-2-chloro-4-fluorophenyl)sulfanylpentanoate.
| Compound Name | propan-2-yl 2-(5-benzamido-2-chloro-4-fluorophenyl)sulfanylpentanoate |
|---|---|
| PubChem CID | 139689716 |
| Molecular Formula | C21H23ClFNO3S |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | propan-2-yl 2-(5-benzamido-2-chloro-4-fluorophenyl)sulfanylpentanoate |
| SMILES | CCCC(Sc1cc(NC(=O)c2ccccc2)c(F)cc1Cl)C(=O)OC(C)C |
| InChI | InChI=1S/C21H23ClFNO3S/c1-4-8-18(21(26)27-13(2)3)28-19-12-17(16(23)11-15(19)22)24-20(25)14-9-6-5-7-10-14/h5-7,9-13,18H,4,8H2,1-3H3,(H,24,25) |
| InChIKey | ZTDWFBZUFTVTQI-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |