C20H21BrFNO3S — CID 139689443
propan-2-yl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylbutanoate (PubChem CID 139689443) has the molecular formula C20H21BrFNO3S and a molecular weight of 454.36 g/mol. Its IUPAC name is propan-2-yl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylbutanoate.
| Compound Name | propan-2-yl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 139689443 |
| Molecular Formula | C20H21BrFNO3S |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | propan-2-yl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylbutanoate |
| SMILES | CCC(Sc1cc(NC(=O)c2ccccc2)c(F)cc1Br)C(=O)OC(C)C |
| InChI | InChI=1S/C20H21BrFNO3S/c1-4-17(20(25)26-12(2)3)27-18-11-16(15(22)10-14(18)21)23-19(24)13-8-6-5-7-9-13/h5-12,17H,4H2,1-3H3,(H,23,24) |
| InChIKey | LWHLYSZZLFUYIC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |