C17H15BrFNO3S — CID 139689558
methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpropanoate (PubChem CID 139689558) has the molecular formula C17H15BrFNO3S and a molecular weight of 412.28 g/mol. Its IUPAC name is methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpropanoate.
| Compound Name | methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 139689558 |
| Molecular Formula | C17H15BrFNO3S |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | methyl 2-(5-benzamido-2-bromo-4-fluorophenyl)sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1cc(NC(=O)c2ccccc2)c(F)cc1Br |
| InChI | InChI=1S/C17H15BrFNO3S/c1-10(17(22)23-2)24-15-9-14(13(19)8-12(15)18)20-16(21)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,20,21) |
| InChIKey | SHOBVYBVNKONCZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |