C20H21F2NO3S — CID 139690098
propan-2-yl 2-(5-benzamido-2,4-difluorophenyl)sulfanylbutanoate (PubChem CID 139690098) has the molecular formula C20H21F2NO3S and a molecular weight of 393.46 g/mol. Its IUPAC name is propan-2-yl 2-(5-benzamido-2,4-difluorophenyl)sulfanylbutanoate.
| Compound Name | propan-2-yl 2-(5-benzamido-2,4-difluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 139690098 |
| Molecular Formula | C20H21F2NO3S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | propan-2-yl 2-(5-benzamido-2,4-difluorophenyl)sulfanylbutanoate |
| SMILES | CCC(Sc1cc(NC(=O)c2ccccc2)c(F)cc1F)C(=O)OC(C)C |
| InChI | InChI=1S/C20H21F2NO3S/c1-4-17(20(25)26-12(2)3)27-18-11-16(14(21)10-15(18)22)23-19(24)13-8-6-5-7-9-13/h5-12,17H,4H2,1-3H3,(H,23,24) |
| InChIKey | CUBJUCQODHTSIE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |