C17H23BrFNO3S — CID 139689964
propan-2-yl 2-[2-bromo-4-fluoro-5-(propanoylamino)phenyl]sulfanylpentanoate (PubChem CID 139689964) has the molecular formula C17H23BrFNO3S and a molecular weight of 420.34 g/mol. Its IUPAC name is propan-2-yl 2-[2-bromo-4-fluoro-5-(propanoylamino)phenyl]sulfanylpentanoate.
| Compound Name | propan-2-yl 2-[2-bromo-4-fluoro-5-(propanoylamino)phenyl]sulfanylpentanoate |
|---|---|
| PubChem CID | 139689964 |
| Molecular Formula | C17H23BrFNO3S |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | propan-2-yl 2-[2-bromo-4-fluoro-5-(propanoylamino)phenyl]sulfanylpentanoate |
| SMILES | CCCC(Sc1cc(NC(=O)CC)c(F)cc1Br)C(=O)OC(C)C |
| InChI | InChI=1S/C17H23BrFNO3S/c1-5-7-14(17(22)23-10(3)4)24-15-9-13(20-16(21)6-2)12(19)8-11(15)18/h8-10,14H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | UMZWJPNVDYEUDR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |