C14H19BrFNO2S — CID 139690133
butan-2-yl 2-(5-amino-2-bromo-4-fluorophenyl)sulfanylbutanoate (PubChem CID 139690133) has the molecular formula C14H19BrFNO2S and a molecular weight of 364.28 g/mol. Its IUPAC name is butan-2-yl 2-(5-amino-2-bromo-4-fluorophenyl)sulfanylbutanoate.
| Compound Name | butan-2-yl 2-(5-amino-2-bromo-4-fluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 139690133 |
| Molecular Formula | C14H19BrFNO2S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | butan-2-yl 2-(5-amino-2-bromo-4-fluorophenyl)sulfanylbutanoate |
| SMILES | CCC(C)OC(=O)C(CC)Sc1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C14H19BrFNO2S/c1-4-8(3)19-14(18)12(5-2)20-13-7-11(17)10(16)6-9(13)15/h6-8,12H,4-5,17H2,1-3H3 |
| InChIKey | JCLHMQPOTTUOAI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|