C14H16BrFO4S — CID 139689203
4-bromo-2-fluoro-5-(1-oxo-1-propoxybutan-2-yl)sulfanylbenzoic acid (PubChem CID 139689203) has the molecular formula C14H16BrFO4S and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-bromo-2-fluoro-5-(1-oxo-1-propoxybutan-2-yl)sulfanylbenzoic acid.
| Compound Name | 4-bromo-2-fluoro-5-(1-oxo-1-propoxybutan-2-yl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 139689203 |
| Molecular Formula | C14H16BrFO4S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 4-bromo-2-fluoro-5-(1-oxo-1-propoxybutan-2-yl)sulfanylbenzoic acid |
| SMILES | CCCOC(=O)C(CC)Sc1cc(C(=O)O)c(F)cc1Br |
| InChI | InChI=1S/C14H16BrFO4S/c1-3-5-20-14(19)11(4-2)21-12-6-8(13(17)18)10(16)7-9(12)15/h6-7,11H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | MTHPMTMTIFPLBD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |