C12H12BrFO4S — CID 139689292
4-bromo-5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2-fluorobenzoic acid (PubChem CID 139689292) has the molecular formula C12H12BrFO4S and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-bromo-5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2-fluorobenzoic acid.
| Compound Name | 4-bromo-5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 139689292 |
| Molecular Formula | C12H12BrFO4S |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 4-bromo-5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2-fluorobenzoic acid |
| SMILES | CCOC(=O)C(C)Sc1cc(C(=O)O)c(F)cc1Br |
| InChI | InChI=1S/C12H12BrFO4S/c1-3-18-12(17)6(2)19-10-4-7(11(15)16)9(14)5-8(10)13/h4-6H,3H2,1-2H3,(H,15,16) |
| InChIKey | WQTBBVWIQMNNEE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |