5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid

C12H12F2O4S — CID 139689260

IUPAC5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid
SMILESCCOC(=O)C(C)Sc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C12H12F2O4S/c1-3-18-12(17)6(2)19-10-4-7(11(15)16)8(13)5-9(10)14/h4-6H,3H2,1-2H3,(H,15,16)
InChIKeyQISCYRYPISEMOB-UHFFFAOYSA-N
MW290.29 g/mol
LogP2.71
Rot. Bonds5

About 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid

5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid (PubChem CID 139689260) has the molecular formula C12H12F2O4S and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid.

Molecular Properties

Compound Name5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid
PubChem CID139689260
Molecular FormulaC12H12F2O4S
Molecular Weight290.29 g/mol
Exact Mass290.04
IUPAC Name5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid
SMILESCCOC(=O)C(C)Sc1cc(C(=O)O)c(F)cc1F
InChIInChI=1S/C12H12F2O4S/c1-3-18-12(17)6(2)19-10-4-7(11(15)16)8(13)5-9(10)14/h4-6H,3H2,1-2H3,(H,15,16)
InChIKeyQISCYRYPISEMOB-UHFFFAOYSA-N
XLogP2.71
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.29
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid?
The IUPAC name of 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid (CID 139689260) is 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid.
What is the SMILES notation for 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid?
The canonical SMILES for 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid is CCOC(=O)C(C)Sc1cc(C(=O)O)c(F)cc1F.
What is the InChIKey of 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid?
The InChIKey is QISCYRYPISEMOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O4S/c1-3-18-12(17)6(2)19-10-4-7(11(15)16)8(13)5-9(10)14/h4-6H,3H2,1-2H3,(H,15,16).
What are the key properties of 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid?
5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid has a molecular weight of 290.29 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethoxy-1-oxopropan-2-yl)sulfanyl-2,4-difluorobenzoic acid is sourced from PubChem (CID 139689260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).